C32H41NO8 — CID 156903462
oxan-2-yl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(3S)-3-(oxan-2-yloxy)butoxy]propanoate (PubChem CID 156903462) has the molecular formula C32H41NO8 and a molecular weight of 567.68 g/mol. Its IUPAC name is oxan-2-yl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(3S)-3-(oxan-2-yloxy)butoxy]propanoate.
| Compound Name | oxan-2-yl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(3S)-3-(oxan-2-yloxy)butoxy]propanoate |
|---|---|
| PubChem CID | 156903462 |
| Molecular Formula | C32H41NO8 |
| Molecular Weight | 567.68 g/mol |
| Exact Mass | 567.28 |
| IUPAC Name | oxan-2-yl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(3S)-3-(oxan-2-yloxy)butoxy]propanoate |
| SMILES | C[C@@H](CCOC[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)OC1CCCCO1)OC1CCCCO1 |
| InChI | InChI=1S/C32H41NO8/c1-22(40-29-14-6-8-17-37-29)16-19-36-21-28(31(34)41-30-15-7-9-18-38-30)33-32(35)39-20-27-25-12-4-2-10-23(25)24-11-3-5-13-26(24)27/h2-5,10-13,22,27-30H,6-9,14-21H2,1H3,(H,33,35)/t22-,28-,29?,30?/m0/s1 |
| InChIKey | IBVPXAIHOUXQGW-UQQYZXGISA-N |
| XLogP | 5.30 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.68 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|