C22H24ClNO5 — CID 163392736
7-[(4-chlorophenyl)methoxy]-N-(oxan-2-yloxy)-3,4-dihydro-2H-chromene-2-carboxamide (PubChem CID 163392736) has the molecular formula C22H24ClNO5 and a molecular weight of 417.89 g/mol. Its IUPAC name is 7-[(4-chlorophenyl)methoxy]-N-(oxan-2-yloxy)-3,4-dihydro-2H-chromene-2-carboxamide.
| Compound Name | 7-[(4-chlorophenyl)methoxy]-N-(oxan-2-yloxy)-3,4-dihydro-2H-chromene-2-carboxamide |
|---|---|
| PubChem CID | 163392736 |
| Molecular Formula | C22H24ClNO5 |
| Molecular Weight | 417.89 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 7-[(4-chlorophenyl)methoxy]-N-(oxan-2-yloxy)-3,4-dihydro-2H-chromene-2-carboxamide |
| SMILES | O=C(NOC1CCCCO1)C1CCc2ccc(OCc3ccc(Cl)cc3)cc2O1 |
| InChI | InChI=1S/C22H24ClNO5/c23-17-8-4-15(5-9-17)14-27-18-10-6-16-7-11-19(28-20(16)13-18)22(25)24-29-21-3-1-2-12-26-21/h4-6,8-10,13,19,21H,1-3,7,11-12,14H2,(H,24,25) |
| InChIKey | RBHURQDCDRJREA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.89 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|