C12H13ClFNO3 — CID 52828159
4-chloro-2-fluoro-N-[(2S)-oxan-2-yl]oxybenzamide (PubChem CID 52828159) has the molecular formula C12H13ClFNO3 and a molecular weight of 273.69 g/mol. Its IUPAC name is 4-chloro-2-fluoro-N-[(2S)-oxan-2-yl]oxybenzamide.
| Compound Name | 4-chloro-2-fluoro-N-[(2S)-oxan-2-yl]oxybenzamide |
|---|---|
| PubChem CID | 52828159 |
| Molecular Formula | C12H13ClFNO3 |
| Molecular Weight | 273.69 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 4-chloro-2-fluoro-N-[(2S)-oxan-2-yl]oxybenzamide |
| SMILES | O=C(NO[C@H]1CCCCO1)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C12H13ClFNO3/c13-8-4-5-9(10(14)7-8)12(16)15-18-11-3-1-2-6-17-11/h4-5,7,11H,1-3,6H2,(H,15,16)/t11-/m0/s1 |
| InChIKey | LOTZKUYOVBHHMP-NSHDSACASA-N |
| XLogP | 2.67 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.69 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|