C14H12Cl3NO3S — CID 60613090
3,4,6-trichloro-N-(oxan-2-yloxy)-1-benzothiophene-2-carboxamide (PubChem CID 60613090) has the molecular formula C14H12Cl3NO3S and a molecular weight of 380.68 g/mol. Its IUPAC name is 3,4,6-trichloro-N-(oxan-2-yloxy)-1-benzothiophene-2-carboxamide.
| Compound Name | 3,4,6-trichloro-N-(oxan-2-yloxy)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 60613090 |
| Molecular Formula | C14H12Cl3NO3S |
| Molecular Weight | 380.68 g/mol |
| Exact Mass | 378.96 |
| IUPAC Name | 3,4,6-trichloro-N-(oxan-2-yloxy)-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NOC1CCCCO1)c1sc2cc(Cl)cc(Cl)c2c1Cl |
| InChI | InChI=1S/C14H12Cl3NO3S/c15-7-5-8(16)11-9(6-7)22-13(12(11)17)14(19)18-21-10-3-1-2-4-20-10/h5-6,10H,1-4H2,(H,18,19) |
| InChIKey | IKTLWGIHUWYNJU-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.68 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|