C14H13Cl3N2O3S — CID 56558671
ethyl N-[2-[(3,4,6-trichloro-1-benzothiophene-2-carbonyl)amino]ethyl]carbamate (PubChem CID 56558671) has the molecular formula C14H13Cl3N2O3S and a molecular weight of 395.70 g/mol. Its IUPAC name is ethyl N-[2-[(3,4,6-trichloro-1-benzothiophene-2-carbonyl)amino]ethyl]carbamate.
| Compound Name | ethyl N-[2-[(3,4,6-trichloro-1-benzothiophene-2-carbonyl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 56558671 |
| Molecular Formula | C14H13Cl3N2O3S |
| Molecular Weight | 395.70 g/mol |
| Exact Mass | 393.97 |
| IUPAC Name | ethyl N-[2-[(3,4,6-trichloro-1-benzothiophene-2-carbonyl)amino]ethyl]carbamate |
| SMILES | CCOC(=O)NCCNC(=O)c1sc2cc(Cl)cc(Cl)c2c1Cl |
| InChI | InChI=1S/C14H13Cl3N2O3S/c1-2-22-14(21)19-4-3-18-13(20)12-11(17)10-8(16)5-7(15)6-9(10)23-12/h5-6H,2-4H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | NHXFSQTUXZONCR-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.70 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|