C14H15Cl2NO2S — CID 35561731
3,4-dichloro-N-(3-ethoxypropyl)-1-benzothiophene-2-carboxamide (PubChem CID 35561731) has the molecular formula C14H15Cl2NO2S and a molecular weight of 332.25 g/mol. Its IUPAC name is 3,4-dichloro-N-(3-ethoxypropyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3,4-dichloro-N-(3-ethoxypropyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 35561731 |
| Molecular Formula | C14H15Cl2NO2S |
| Molecular Weight | 332.25 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | 3,4-dichloro-N-(3-ethoxypropyl)-1-benzothiophene-2-carboxamide |
| SMILES | CCOCCCNC(=O)c1sc2cccc(Cl)c2c1Cl |
| InChI | InChI=1S/C14H15Cl2NO2S/c1-2-19-8-4-7-17-14(18)13-12(16)11-9(15)5-3-6-10(11)20-13/h3,5-6H,2,4,7-8H2,1H3,(H,17,18) |
| InChIKey | BNMFSRPJNWBMKT-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.25 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|