C18H15Cl2NOS — CID 2931377
3,4-dichloro-N-(1-phenylpropyl)-1-benzothiophene-2-carboxamide (PubChem CID 2931377) has the molecular formula C18H15Cl2NOS and a molecular weight of 364.30 g/mol. Its IUPAC name is 3,4-dichloro-N-(1-phenylpropyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3,4-dichloro-N-(1-phenylpropyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 2931377 |
| Molecular Formula | C18H15Cl2NOS |
| Molecular Weight | 364.30 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | 3,4-dichloro-N-(1-phenylpropyl)-1-benzothiophene-2-carboxamide |
| SMILES | CCC(NC(=O)c1sc2cccc(Cl)c2c1Cl)c1ccccc1 |
| InChI | InChI=1S/C18H15Cl2NOS/c1-2-13(11-7-4-3-5-8-11)21-18(22)17-16(20)15-12(19)9-6-10-14(15)23-17/h3-10,13H,2H2,1H3,(H,21,22) |
| InChIKey | CGUCZWSMIGOMDG-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.30 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |