C14H18ClN3OS — CID 82950351
3-amino-4-chloro-N-[1-(dimethylamino)propan-2-yl]-1-benzothiophene-2-carboxamide (PubChem CID 82950351) has the molecular formula C14H18ClN3OS and a molecular weight of 311.84 g/mol. Its IUPAC name is 3-amino-4-chloro-N-[1-(dimethylamino)propan-2-yl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-amino-4-chloro-N-[1-(dimethylamino)propan-2-yl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 82950351 |
| Molecular Formula | C14H18ClN3OS |
| Molecular Weight | 311.84 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 3-amino-4-chloro-N-[1-(dimethylamino)propan-2-yl]-1-benzothiophene-2-carboxamide |
| SMILES | CC(CN(C)C)NC(=O)c1sc2cccc(Cl)c2c1N |
| InChI | InChI=1S/C14H18ClN3OS/c1-8(7-18(2)3)17-14(19)13-12(16)11-9(15)5-4-6-10(11)20-13/h4-6,8H,7,16H2,1-3H3,(H,17,19) |
| InChIKey | ITWKAVYCDNPEIN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.84 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |