C9H6ClNO2S — CID 84791715
3-amino-4-chloro-1-benzothiophene-2-carboxylic acid (PubChem CID 84791715) has the molecular formula C9H6ClNO2S and a molecular weight of 227.67 g/mol. Its IUPAC name is 3-amino-4-chloro-1-benzothiophene-2-carboxylic acid.
| Compound Name | 3-amino-4-chloro-1-benzothiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 84791715 |
| Molecular Formula | C9H6ClNO2S |
| Molecular Weight | 227.67 g/mol |
| Exact Mass | 226.98 |
| IUPAC Name | 3-amino-4-chloro-1-benzothiophene-2-carboxylic acid |
| SMILES | Nc1c(C(=O)O)sc2cccc(Cl)c12 |
| InChI | InChI=1S/C9H6ClNO2S/c10-4-2-1-3-5-6(4)7(11)8(14-5)9(12)13/h1-3H,11H2,(H,12,13) |
| InChIKey | DZLDSHBBPZMTQG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.67 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |