C15H8BrCl2NOS — CID 994741
N-(2-bromophenyl)-3,4-dichloro-1-benzothiophene-2-carboxamide (PubChem CID 994741) has the molecular formula C15H8BrCl2NOS and a molecular weight of 401.11 g/mol. Its IUPAC name is N-(2-bromophenyl)-3,4-dichloro-1-benzothiophene-2-carboxamide.
| Compound Name | N-(2-bromophenyl)-3,4-dichloro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 994741 |
| Molecular Formula | C15H8BrCl2NOS |
| Molecular Weight | 401.11 g/mol |
| Exact Mass | 398.89 |
| IUPAC Name | N-(2-bromophenyl)-3,4-dichloro-1-benzothiophene-2-carboxamide |
| SMILES | O=C(Nc1ccccc1Br)c1sc2cccc(Cl)c2c1Cl |
| InChI | InChI=1S/C15H8BrCl2NOS/c16-8-4-1-2-6-10(8)19-15(20)14-13(18)12-9(17)5-3-7-11(12)21-14/h1-7H,(H,19,20) |
| InChIKey | KGERBLOXSSPSPY-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.11 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |