C15H8Cl2N2O3S — CID 2933416
3,4-dichloro-N-(2-nitrophenyl)-1-benzothiophene-2-carboxamide (PubChem CID 2933416) has the molecular formula C15H8Cl2N2O3S and a molecular weight of 367.21 g/mol. Its IUPAC name is 3,4-dichloro-N-(2-nitrophenyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3,4-dichloro-N-(2-nitrophenyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 2933416 |
| Molecular Formula | C15H8Cl2N2O3S |
| Molecular Weight | 367.21 g/mol |
| Exact Mass | 365.96 |
| IUPAC Name | 3,4-dichloro-N-(2-nitrophenyl)-1-benzothiophene-2-carboxamide |
| SMILES | O=C(Nc1ccccc1[N+](=O)[O-])c1sc2cccc(Cl)c2c1Cl |
| InChI | InChI=1S/C15H8Cl2N2O3S/c16-8-4-3-7-11-12(8)13(17)14(23-11)15(20)18-9-5-1-2-6-10(9)19(21)22/h1-7H,(H,18,20) |
| InChIKey | CZWOUHUDYMHOCP-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.21 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|