C16H10Cl2N2O3S — CID 1124678
3,4-dichloro-N-(4-methyl-3-nitrophenyl)-1-benzothiophene-2-carboxamide (PubChem CID 1124678) has the molecular formula C16H10Cl2N2O3S and a molecular weight of 381.24 g/mol. Its IUPAC name is 3,4-dichloro-N-(4-methyl-3-nitrophenyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3,4-dichloro-N-(4-methyl-3-nitrophenyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 1124678 |
| Molecular Formula | C16H10Cl2N2O3S |
| Molecular Weight | 381.24 g/mol |
| Exact Mass | 379.98 |
| IUPAC Name | 3,4-dichloro-N-(4-methyl-3-nitrophenyl)-1-benzothiophene-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2sc3cccc(Cl)c3c2Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H10Cl2N2O3S/c1-8-5-6-9(7-11(8)20(22)23)19-16(21)15-14(18)13-10(17)3-2-4-12(13)24-15/h2-7H,1H3,(H,19,21) |
| InChIKey | QIRPVBJYLFIVEO-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.24 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|