C17H13Cl2NOS — CID 997805
3,4-dichloro-N-(3-ethylphenyl)-1-benzothiophene-2-carboxamide (PubChem CID 997805) has the molecular formula C17H13Cl2NOS and a molecular weight of 350.27 g/mol. Its IUPAC name is 3,4-dichloro-N-(3-ethylphenyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3,4-dichloro-N-(3-ethylphenyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 997805 |
| Molecular Formula | C17H13Cl2NOS |
| Molecular Weight | 350.27 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | 3,4-dichloro-N-(3-ethylphenyl)-1-benzothiophene-2-carboxamide |
| SMILES | CCc1cccc(NC(=O)c2sc3cccc(Cl)c3c2Cl)c1 |
| InChI | InChI=1S/C17H13Cl2NOS/c1-2-10-5-3-6-11(9-10)20-17(21)16-15(19)14-12(18)7-4-8-13(14)22-16/h3-9H,2H2,1H3,(H,20,21) |
| InChIKey | PFUBRCUIHDEMHI-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.27 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |