C15H8Cl2INOS — CID 1124680
3,4-dichloro-N-(3-iodophenyl)-1-benzothiophene-2-carboxamide (PubChem CID 1124680) has the molecular formula C15H8Cl2INOS and a molecular weight of 448.11 g/mol. Its IUPAC name is 3,4-dichloro-N-(3-iodophenyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3,4-dichloro-N-(3-iodophenyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 1124680 |
| Molecular Formula | C15H8Cl2INOS |
| Molecular Weight | 448.11 g/mol |
| Exact Mass | 446.87 |
| IUPAC Name | 3,4-dichloro-N-(3-iodophenyl)-1-benzothiophene-2-carboxamide |
| SMILES | O=C(Nc1cccc(I)c1)c1sc2cccc(Cl)c2c1Cl |
| InChI | InChI=1S/C15H8Cl2INOS/c16-10-5-2-6-11-12(10)13(17)14(21-11)15(20)19-9-4-1-3-8(18)7-9/h1-7H,(H,19,20) |
| InChIKey | WZBIZGNLBVGTJF-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.11 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|