C13H9ClN2OS2 — CID 66354000
3-amino-4-chloro-N-thiophen-3-yl-1-benzothiophene-2-carboxamide (PubChem CID 66354000) has the molecular formula C13H9ClN2OS2 and a molecular weight of 308.82 g/mol. Its IUPAC name is 3-amino-4-chloro-N-thiophen-3-yl-1-benzothiophene-2-carboxamide.
| Compound Name | 3-amino-4-chloro-N-thiophen-3-yl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 66354000 |
| Molecular Formula | C13H9ClN2OS2 |
| Molecular Weight | 308.82 g/mol |
| Exact Mass | 307.98 |
| IUPAC Name | 3-amino-4-chloro-N-thiophen-3-yl-1-benzothiophene-2-carboxamide |
| SMILES | Nc1c(C(=O)Nc2ccsc2)sc2cccc(Cl)c12 |
| InChI | InChI=1S/C13H9ClN2OS2/c14-8-2-1-3-9-10(8)11(15)12(19-9)13(17)16-7-4-5-18-6-7/h1-6H,15H2,(H,16,17) |
| InChIKey | UGPKEHFMBUJKOT-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.82 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |