C15H17ClN2O2S — CID 103340529
3-amino-4-chloro-N-(2-methoxyethyl)-N-prop-2-enyl-1-benzothiophene-2-carboxamide (PubChem CID 103340529) has the molecular formula C15H17ClN2O2S and a molecular weight of 324.83 g/mol. Its IUPAC name is 3-amino-4-chloro-N-(2-methoxyethyl)-N-prop-2-enyl-1-benzothiophene-2-carboxamide.
| Compound Name | 3-amino-4-chloro-N-(2-methoxyethyl)-N-prop-2-enyl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 103340529 |
| Molecular Formula | C15H17ClN2O2S |
| Molecular Weight | 324.83 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 3-amino-4-chloro-N-(2-methoxyethyl)-N-prop-2-enyl-1-benzothiophene-2-carboxamide |
| SMILES | C=CCN(CCOC)C(=O)c1sc2cccc(Cl)c2c1N |
| InChI | InChI=1S/C15H17ClN2O2S/c1-3-7-18(8-9-20-2)15(19)14-13(17)12-10(16)5-4-6-11(12)21-14/h3-6H,1,7-9,17H2,2H3 |
| InChIKey | RVVDMEBNHORYIT-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.83 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|