C10H15N3O2S — CID 103338894
2-amino-N-(2-methoxyethyl)-N-prop-2-enyl-1,3-thiazole-4-carboxamide (PubChem CID 103338894) has the molecular formula C10H15N3O2S and a molecular weight of 241.32 g/mol. Its IUPAC name is 2-amino-N-(2-methoxyethyl)-N-prop-2-enyl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-amino-N-(2-methoxyethyl)-N-prop-2-enyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 103338894 |
| Molecular Formula | C10H15N3O2S |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 2-amino-N-(2-methoxyethyl)-N-prop-2-enyl-1,3-thiazole-4-carboxamide |
| SMILES | C=CCN(CCOC)C(=O)c1csc(N)n1 |
| InChI | InChI=1S/C10H15N3O2S/c1-3-4-13(5-6-15-2)9(14)8-7-16-10(11)12-8/h3,7H,1,4-6H2,2H3,(H2,11,12) |
| InChIKey | LWQMOIWXFRTPSZ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|