C15H22N2O4 — CID 103338349
2-amino-3,5-dimethoxy-N-(2-methoxyethyl)-N-prop-2-enylbenzamide (PubChem CID 103338349) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is 2-amino-3,5-dimethoxy-N-(2-methoxyethyl)-N-prop-2-enylbenzamide.
| Compound Name | 2-amino-3,5-dimethoxy-N-(2-methoxyethyl)-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 103338349 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 2-amino-3,5-dimethoxy-N-(2-methoxyethyl)-N-prop-2-enylbenzamide |
| SMILES | C=CCN(CCOC)C(=O)c1cc(OC)cc(OC)c1N |
| InChI | InChI=1S/C15H22N2O4/c1-5-6-17(7-8-19-2)15(18)12-9-11(20-3)10-13(21-4)14(12)16/h5,9-10H,1,6-8,16H2,2-4H3 |
| InChIKey | WHNASZJNVQKFBQ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|