C16H18N2OS — CID 107932072
3-amino-5-methyl-N,N-bis(prop-2-enyl)-1-benzothiophene-2-carboxamide (PubChem CID 107932072) has the molecular formula C16H18N2OS and a molecular weight of 286.40 g/mol. Its IUPAC name is 3-amino-5-methyl-N,N-bis(prop-2-enyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3-amino-5-methyl-N,N-bis(prop-2-enyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 107932072 |
| Molecular Formula | C16H18N2OS |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 3-amino-5-methyl-N,N-bis(prop-2-enyl)-1-benzothiophene-2-carboxamide |
| SMILES | C=CCN(CC=C)C(=O)c1sc2ccc(C)cc2c1N |
| InChI | InChI=1S/C16H18N2OS/c1-4-8-18(9-5-2)16(19)15-14(17)12-10-11(3)6-7-13(12)20-15/h4-7,10H,1-2,8-9,17H2,3H3 |
| InChIKey | ILRJHEOINGROGJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|