C23H23NOS — CID 110498452
3-[(4-methylphenyl)methyl]-N,N-bis(prop-2-enyl)-1-benzothiophene-2-carboxamide (PubChem CID 110498452) has the molecular formula C23H23NOS and a molecular weight of 361.51 g/mol. Its IUPAC name is 3-[(4-methylphenyl)methyl]-N,N-bis(prop-2-enyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3-[(4-methylphenyl)methyl]-N,N-bis(prop-2-enyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 110498452 |
| Molecular Formula | C23H23NOS |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 3-[(4-methylphenyl)methyl]-N,N-bis(prop-2-enyl)-1-benzothiophene-2-carboxamide |
| SMILES | C=CCN(CC=C)C(=O)c1sc2ccccc2c1Cc1ccc(C)cc1 |
| InChI | InChI=1S/C23H23NOS/c1-4-14-24(15-5-2)23(25)22-20(16-18-12-10-17(3)11-13-18)19-8-6-7-9-21(19)26-22/h4-13H,1-2,14-16H2,3H3 |
| InChIKey | JACZTERTACKNHR-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|