C23H18FNOS — CID 110500611
N-(4-fluorophenyl)-3-[(4-methylphenyl)methyl]-1-benzothiophene-2-carboxamide (PubChem CID 110500611) has the molecular formula C23H18FNOS and a molecular weight of 375.47 g/mol. Its IUPAC name is N-(4-fluorophenyl)-3-[(4-methylphenyl)methyl]-1-benzothiophene-2-carboxamide.
| Compound Name | N-(4-fluorophenyl)-3-[(4-methylphenyl)methyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 110500611 |
| Molecular Formula | C23H18FNOS |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | N-(4-fluorophenyl)-3-[(4-methylphenyl)methyl]-1-benzothiophene-2-carboxamide |
| SMILES | Cc1ccc(Cc2c(C(=O)Nc3ccc(F)cc3)sc3ccccc23)cc1 |
| InChI | InChI=1S/C23H18FNOS/c1-15-6-8-16(9-7-15)14-20-19-4-2-3-5-21(19)27-22(20)23(26)25-18-12-10-17(24)11-13-18/h2-13H,14H2,1H3,(H,25,26) |
| InChIKey | NEIUCZRWYJLFMF-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |