C24H20BrNOS — CID 110500748
N-(4-bromo-3-methylphenyl)-3-[(4-methylphenyl)methyl]-1-benzothiophene-2-carboxamide (PubChem CID 110500748) has the molecular formula C24H20BrNOS and a molecular weight of 450.40 g/mol. Its IUPAC name is N-(4-bromo-3-methylphenyl)-3-[(4-methylphenyl)methyl]-1-benzothiophene-2-carboxamide.
| Compound Name | N-(4-bromo-3-methylphenyl)-3-[(4-methylphenyl)methyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 110500748 |
| Molecular Formula | C24H20BrNOS |
| Molecular Weight | 450.40 g/mol |
| Exact Mass | 449.04 |
| IUPAC Name | N-(4-bromo-3-methylphenyl)-3-[(4-methylphenyl)methyl]-1-benzothiophene-2-carboxamide |
| SMILES | Cc1ccc(Cc2c(C(=O)Nc3ccc(Br)c(C)c3)sc3ccccc23)cc1 |
| InChI | InChI=1S/C24H20BrNOS/c1-15-7-9-17(10-8-15)14-20-19-5-3-4-6-22(19)28-23(20)24(27)26-18-11-12-21(25)16(2)13-18/h3-13H,14H2,1-2H3,(H,26,27) |
| InChIKey | OQBZNTDPUQWWQN-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.40 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |