C22H17BrN2OS — CID 110500759
N-(5-bromo-2-pyridinyl)-3-[(4-methylphenyl)methyl]-1-benzothiophene-2-carboxamide (PubChem CID 110500759) has the molecular formula C22H17BrN2OS and a molecular weight of 437.36 g/mol. Its IUPAC name is N-(5-bromo-2-pyridinyl)-3-[(4-methylphenyl)methyl]-1-benzothiophene-2-carboxamide.
| Compound Name | N-(5-bromo-2-pyridinyl)-3-[(4-methylphenyl)methyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 110500759 |
| Molecular Formula | C22H17BrN2OS |
| Molecular Weight | 437.36 g/mol |
| Exact Mass | 436.02 |
| IUPAC Name | N-(5-bromo-2-pyridinyl)-3-[(4-methylphenyl)methyl]-1-benzothiophene-2-carboxamide |
| SMILES | Cc1ccc(Cc2c(C(=O)Nc3ccc(Br)cn3)sc3ccccc23)cc1 |
| InChI | InChI=1S/C22H17BrN2OS/c1-14-6-8-15(9-7-14)12-18-17-4-2-3-5-19(17)27-21(18)22(26)25-20-11-10-16(23)13-24-20/h2-11,13H,12H2,1H3,(H,24,25,26) |
| InChIKey | OOLRIRNZVPWDFY-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.36 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |