C24H20ClNOS — CID 110500604
N-(5-chloro-2-methylphenyl)-3-[(4-methylphenyl)methyl]-1-benzothiophene-2-carboxamide (PubChem CID 110500604) has the molecular formula C24H20ClNOS and a molecular weight of 405.95 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-3-[(4-methylphenyl)methyl]-1-benzothiophene-2-carboxamide.
| Compound Name | N-(5-chloro-2-methylphenyl)-3-[(4-methylphenyl)methyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 110500604 |
| Molecular Formula | C24H20ClNOS |
| Molecular Weight | 405.95 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-3-[(4-methylphenyl)methyl]-1-benzothiophene-2-carboxamide |
| SMILES | Cc1ccc(Cc2c(C(=O)Nc3cc(Cl)ccc3C)sc3ccccc23)cc1 |
| InChI | InChI=1S/C24H20ClNOS/c1-15-7-10-17(11-8-15)13-20-19-5-3-4-6-22(19)28-23(20)24(27)26-21-14-18(25)12-9-16(21)2/h3-12,14H,13H2,1-2H3,(H,26,27) |
| InChIKey | MKPPNOSTFWHFCX-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.95 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |