C31H21NO3S — CID 110500725
N-(9,10-dioxoanthracen-2-yl)-3-[(4-methylphenyl)methyl]-1-benzothiophene-2-carboxamide (PubChem CID 110500725) has the molecular formula C31H21NO3S and a molecular weight of 487.58 g/mol. Its IUPAC name is N-(9,10-dioxoanthracen-2-yl)-3-[(4-methylphenyl)methyl]-1-benzothiophene-2-carboxamide.
| Compound Name | N-(9,10-dioxoanthracen-2-yl)-3-[(4-methylphenyl)methyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 110500725 |
| Molecular Formula | C31H21NO3S |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | N-(9,10-dioxoanthracen-2-yl)-3-[(4-methylphenyl)methyl]-1-benzothiophene-2-carboxamide |
| SMILES | Cc1ccc(Cc2c(C(=O)Nc3ccc4c(c3)C(=O)c3ccccc3C4=O)sc3ccccc23)cc1 |
| InChI | InChI=1S/C31H21NO3S/c1-18-10-12-19(13-11-18)16-26-21-6-4-5-9-27(21)36-30(26)31(35)32-20-14-15-24-25(17-20)29(34)23-8-3-2-7-22(23)28(24)33/h2-15,17H,16H2,1H3,(H,32,35) |
| InChIKey | AIYHLSFEXSFSDL-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|