C24H19NO3S — CID 110500632
3-[[3-[(4-methylphenyl)methyl]-1-benzothiophene-2-carbonyl]amino]benzoic acid (PubChem CID 110500632) has the molecular formula C24H19NO3S and a molecular weight of 401.49 g/mol. Its IUPAC name is 3-[[3-[(4-methylphenyl)methyl]-1-benzothiophene-2-carbonyl]amino]benzoic acid.
| Compound Name | 3-[[3-[(4-methylphenyl)methyl]-1-benzothiophene-2-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 110500632 |
| Molecular Formula | C24H19NO3S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 3-[[3-[(4-methylphenyl)methyl]-1-benzothiophene-2-carbonyl]amino]benzoic acid |
| SMILES | Cc1ccc(Cc2c(C(=O)Nc3cccc(C(=O)O)c3)sc3ccccc23)cc1 |
| InChI | InChI=1S/C24H19NO3S/c1-15-9-11-16(12-10-15)13-20-19-7-2-3-8-21(19)29-22(20)23(26)25-18-6-4-5-17(14-18)24(27)28/h2-12,14H,13H2,1H3,(H,25,26)(H,27,28) |
| InChIKey | RQHQORAOKOLPCY-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |