C25H21NO3S — CID 110500716
4-methyl-3-[[3-[(4-methylphenyl)methyl]-1-benzothiophene-2-carbonyl]amino]benzoic acid (PubChem CID 110500716) has the molecular formula C25H21NO3S and a molecular weight of 415.51 g/mol. Its IUPAC name is 4-methyl-3-[[3-[(4-methylphenyl)methyl]-1-benzothiophene-2-carbonyl]amino]benzoic acid.
| Compound Name | 4-methyl-3-[[3-[(4-methylphenyl)methyl]-1-benzothiophene-2-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 110500716 |
| Molecular Formula | C25H21NO3S |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 4-methyl-3-[[3-[(4-methylphenyl)methyl]-1-benzothiophene-2-carbonyl]amino]benzoic acid |
| SMILES | Cc1ccc(Cc2c(C(=O)Nc3cc(C(=O)O)ccc3C)sc3ccccc23)cc1 |
| InChI | InChI=1S/C25H21NO3S/c1-15-7-10-17(11-8-15)13-20-19-5-3-4-6-22(19)30-23(20)24(27)26-21-14-18(25(28)29)12-9-16(21)2/h3-12,14H,13H2,1-2H3,(H,26,27)(H,28,29) |
| InChIKey | MVOBAYBWFCPTKC-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |