C13H16N2O3S2 — CID 107932222
3-amino-5-methyl-N-(2-methylsulfonylethyl)-1-benzothiophene-2-carboxamide (PubChem CID 107932222) has the molecular formula C13H16N2O3S2 and a molecular weight of 312.42 g/mol. Its IUPAC name is 3-amino-5-methyl-N-(2-methylsulfonylethyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3-amino-5-methyl-N-(2-methylsulfonylethyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 107932222 |
| Molecular Formula | C13H16N2O3S2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 3-amino-5-methyl-N-(2-methylsulfonylethyl)-1-benzothiophene-2-carboxamide |
| SMILES | Cc1ccc2sc(C(=O)NCCS(C)(=O)=O)c(N)c2c1 |
| InChI | InChI=1S/C13H16N2O3S2/c1-8-3-4-10-9(7-8)11(14)12(19-10)13(16)15-5-6-20(2,17)18/h3-4,7H,5-6,14H2,1-2H3,(H,15,16) |
| InChIKey | AJPYRTQEYGIUMA-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |