C14H17N3O2S — CID 107932219
3-amino-N-(4-amino-4-oxobutyl)-5-methyl-1-benzothiophene-2-carboxamide (PubChem CID 107932219) has the molecular formula C14H17N3O2S and a molecular weight of 291.38 g/mol. Its IUPAC name is 3-amino-N-(4-amino-4-oxobutyl)-5-methyl-1-benzothiophene-2-carboxamide.
| Compound Name | 3-amino-N-(4-amino-4-oxobutyl)-5-methyl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 107932219 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 3-amino-N-(4-amino-4-oxobutyl)-5-methyl-1-benzothiophene-2-carboxamide |
| SMILES | Cc1ccc2sc(C(=O)NCCCC(N)=O)c(N)c2c1 |
| InChI | InChI=1S/C14H17N3O2S/c1-8-4-5-10-9(7-8)12(16)13(20-10)14(19)17-6-2-3-11(15)18/h4-5,7H,2-3,6,16H2,1H3,(H2,15,18)(H,17,19) |
| InChIKey | VIFFNORWSGSHEY-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|