C16H20N2O2S — CID 107932303
3-amino-5-methyl-N-[2-(oxolan-2-yl)ethyl]-1-benzothiophene-2-carboxamide (PubChem CID 107932303) has the molecular formula C16H20N2O2S and a molecular weight of 304.41 g/mol. Its IUPAC name is 3-amino-5-methyl-N-[2-(oxolan-2-yl)ethyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-amino-5-methyl-N-[2-(oxolan-2-yl)ethyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 107932303 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 3-amino-5-methyl-N-[2-(oxolan-2-yl)ethyl]-1-benzothiophene-2-carboxamide |
| SMILES | Cc1ccc2sc(C(=O)NCCC3CCCO3)c(N)c2c1 |
| InChI | InChI=1S/C16H20N2O2S/c1-10-4-5-13-12(9-10)14(17)15(21-13)16(19)18-7-6-11-3-2-8-20-11/h4-5,9,11H,2-3,6-8,17H2,1H3,(H,18,19) |
| InChIKey | COMXILUTFCMLDL-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |