C15H13BrN2OS2 — CID 107932455
3-amino-N-[(3-bromothiophen-2-yl)methyl]-5-methyl-1-benzothiophene-2-carboxamide (PubChem CID 107932455) has the molecular formula C15H13BrN2OS2 and a molecular weight of 381.32 g/mol. Its IUPAC name is 3-amino-N-[(3-bromothiophen-2-yl)methyl]-5-methyl-1-benzothiophene-2-carboxamide.
| Compound Name | 3-amino-N-[(3-bromothiophen-2-yl)methyl]-5-methyl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 107932455 |
| Molecular Formula | C15H13BrN2OS2 |
| Molecular Weight | 381.32 g/mol |
| Exact Mass | 379.97 |
| IUPAC Name | 3-amino-N-[(3-bromothiophen-2-yl)methyl]-5-methyl-1-benzothiophene-2-carboxamide |
| SMILES | Cc1ccc2sc(C(=O)NCc3sccc3Br)c(N)c2c1 |
| InChI | InChI=1S/C15H13BrN2OS2/c1-8-2-3-11-9(6-8)13(17)14(21-11)15(19)18-7-12-10(16)4-5-20-12/h2-6H,7,17H2,1H3,(H,18,19) |
| InChIKey | OMENIOHMZOCHKU-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.32 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |