C14H16Cl2N2OS — CID 39854884
3,4-dichloro-N-[3-(dimethylamino)propyl]-1-benzothiophene-2-carboxamide (PubChem CID 39854884) has the molecular formula C14H16Cl2N2OS and a molecular weight of 331.27 g/mol. Its IUPAC name is 3,4-dichloro-N-[3-(dimethylamino)propyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3,4-dichloro-N-[3-(dimethylamino)propyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 39854884 |
| Molecular Formula | C14H16Cl2N2OS |
| Molecular Weight | 331.27 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 3,4-dichloro-N-[3-(dimethylamino)propyl]-1-benzothiophene-2-carboxamide |
| SMILES | CN(C)CCCNC(=O)c1sc2cccc(Cl)c2c1Cl |
| InChI | InChI=1S/C14H16Cl2N2OS/c1-18(2)8-4-7-17-14(19)13-12(16)11-9(15)5-3-6-10(11)20-13/h3,5-6H,4,7-8H2,1-2H3,(H,17,19) |
| InChIKey | XDEOYQOCIZDLIL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.27 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|