C17H14Cl2N2O3S2 — CID 35141026
3,4-dichloro-N-[2-(4-sulfamoylphenyl)ethyl]-1-benzothiophene-2-carboxamide (PubChem CID 35141026) has the molecular formula C17H14Cl2N2O3S2 and a molecular weight of 429.35 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-(4-sulfamoylphenyl)ethyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3,4-dichloro-N-[2-(4-sulfamoylphenyl)ethyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 35141026 |
| Molecular Formula | C17H14Cl2N2O3S2 |
| Molecular Weight | 429.35 g/mol |
| Exact Mass | 427.98 |
| IUPAC Name | 3,4-dichloro-N-[2-(4-sulfamoylphenyl)ethyl]-1-benzothiophene-2-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)c2sc3cccc(Cl)c3c2Cl)cc1 |
| InChI | InChI=1S/C17H14Cl2N2O3S2/c18-12-2-1-3-13-14(12)15(19)16(25-13)17(22)21-9-8-10-4-6-11(7-5-10)26(20,23)24/h1-7H,8-9H2,(H,21,22)(H2,20,23,24) |
| InChIKey | OPIAWOZBDDPCRR-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.35 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |