C13H14N4O3S — CID 165352801
N-[2-(4-sulfamoylphenyl)ethyl]pyridazine-3-carboxamide (PubChem CID 165352801) has the molecular formula C13H14N4O3S and a molecular weight of 306.35 g/mol. Its IUPAC name is N-[2-(4-sulfamoylphenyl)ethyl]pyridazine-3-carboxamide.
| Compound Name | N-[2-(4-sulfamoylphenyl)ethyl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 165352801 |
| Molecular Formula | C13H14N4O3S |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | N-[2-(4-sulfamoylphenyl)ethyl]pyridazine-3-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)c2cccnn2)cc1 |
| InChI | InChI=1S/C13H14N4O3S/c14-21(19,20)11-5-3-10(4-6-11)7-9-15-13(18)12-2-1-8-16-17-12/h1-6,8H,7,9H2,(H,15,18)(H2,14,19,20) |
| InChIKey | XEDCZBUREGPBCP-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |