C18H18N4O3S — CID 52998688
1-pyridin-3-yl-N-[2-(4-sulfamoylphenyl)ethyl]pyrrole-2-carboxamide (PubChem CID 52998688) has the molecular formula C18H18N4O3S and a molecular weight of 370.43 g/mol. Its IUPAC name is 1-pyridin-3-yl-N-[2-(4-sulfamoylphenyl)ethyl]pyrrole-2-carboxamide.
| Compound Name | 1-pyridin-3-yl-N-[2-(4-sulfamoylphenyl)ethyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 52998688 |
| Molecular Formula | C18H18N4O3S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 1-pyridin-3-yl-N-[2-(4-sulfamoylphenyl)ethyl]pyrrole-2-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)c2cccn2-c2cccnc2)cc1 |
| InChI | InChI=1S/C18H18N4O3S/c19-26(24,25)16-7-5-14(6-8-16)9-11-21-18(23)17-4-2-12-22(17)15-3-1-10-20-13-15/h1-8,10,12-13H,9,11H2,(H,21,23)(H2,19,24,25) |
| InChIKey | OHVFNUKZHNWUBM-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |