C19H18IN3O3S — CID 60604256
1-(3-iodophenyl)-N-[2-(4-sulfamoylphenyl)ethyl]pyrrole-2-carboxamide (PubChem CID 60604256) has the molecular formula C19H18IN3O3S and a molecular weight of 495.34 g/mol. Its IUPAC name is 1-(3-iodophenyl)-N-[2-(4-sulfamoylphenyl)ethyl]pyrrole-2-carboxamide.
| Compound Name | 1-(3-iodophenyl)-N-[2-(4-sulfamoylphenyl)ethyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 60604256 |
| Molecular Formula | C19H18IN3O3S |
| Molecular Weight | 495.34 g/mol |
| Exact Mass | 495.01 |
| IUPAC Name | 1-(3-iodophenyl)-N-[2-(4-sulfamoylphenyl)ethyl]pyrrole-2-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)c2cccn2-c2cccc(I)c2)cc1 |
| InChI | InChI=1S/C19H18IN3O3S/c20-15-3-1-4-16(13-15)23-12-2-5-18(23)19(24)22-11-10-14-6-8-17(9-7-14)27(21,25)26/h1-9,12-13H,10-11H2,(H,22,24)(H2,21,25,26) |
| InChIKey | NIKKMYRVMFPIRR-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|