C18H24N4O — CID 53054891
1-pyridin-3-yl-N-(3-pyrrolidin-1-ylbutyl)pyrrole-2-carboxamide (PubChem CID 53054891) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is 1-pyridin-3-yl-N-(3-pyrrolidin-1-ylbutyl)pyrrole-2-carboxamide.
| Compound Name | 1-pyridin-3-yl-N-(3-pyrrolidin-1-ylbutyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 53054891 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 1-pyridin-3-yl-N-(3-pyrrolidin-1-ylbutyl)pyrrole-2-carboxamide |
| SMILES | CC(CCNC(=O)c1cccn1-c1cccnc1)N1CCCC1 |
| InChI | InChI=1S/C18H24N4O/c1-15(21-11-2-3-12-21)8-10-20-18(23)17-7-5-13-22(17)16-6-4-9-19-14-16/h4-7,9,13-15H,2-3,8,10-12H2,1H3,(H,20,23) |
| InChIKey | DPXHCDQXYKNXDH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |