C25H29N5O2 — CID 95064495
(3S)-N-[[4-(dimethylamino)phenyl]methyl]-1-(1-pyridin-3-ylpyrrole-2-carbonyl)piperidine-3-carboxamide (PubChem CID 95064495) has the molecular formula C25H29N5O2 and a molecular weight of 431.54 g/mol. Its IUPAC name is (3S)-N-[[4-(dimethylamino)phenyl]methyl]-1-(1-pyridin-3-ylpyrrole-2-carbonyl)piperidine-3-carboxamide.
| Compound Name | (3S)-N-[[4-(dimethylamino)phenyl]methyl]-1-(1-pyridin-3-ylpyrrole-2-carbonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 95064495 |
| Molecular Formula | C25H29N5O2 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | (3S)-N-[[4-(dimethylamino)phenyl]methyl]-1-(1-pyridin-3-ylpyrrole-2-carbonyl)piperidine-3-carboxamide |
| SMILES | CN(C)c1ccc(CNC(=O)[C@H]2CCCN(C(=O)c3cccn3-c3cccnc3)C2)cc1 |
| InChI | InChI=1S/C25H29N5O2/c1-28(2)21-11-9-19(10-12-21)16-27-24(31)20-6-4-14-29(18-20)25(32)23-8-5-15-30(23)22-7-3-13-26-17-22/h3,5,7-13,15,17,20H,4,6,14,16,18H2,1-2H3,(H,27,31)/t20-/m0/s1 |
| InChIKey | UCZOAQVWMPZOJK-FQEVSTJZSA-N |
| XLogP | 3.11 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|