C30H39N5O — CID 95082723
N-[(3R)-3-(azepan-1-yl)butyl]-1-(4-phenylpiperazin-1-yl)isoquinoline-7-carboxamide (PubChem CID 95082723) has the molecular formula C30H39N5O and a molecular weight of 485.68 g/mol. Its IUPAC name is N-[(3R)-3-(azepan-1-yl)butyl]-1-(4-phenylpiperazin-1-yl)isoquinoline-7-carboxamide.
| Compound Name | N-[(3R)-3-(azepan-1-yl)butyl]-1-(4-phenylpiperazin-1-yl)isoquinoline-7-carboxamide |
|---|---|
| PubChem CID | 95082723 |
| Molecular Formula | C30H39N5O |
| Molecular Weight | 485.68 g/mol |
| Exact Mass | 485.32 |
| IUPAC Name | N-[(3R)-3-(azepan-1-yl)butyl]-1-(4-phenylpiperazin-1-yl)isoquinoline-7-carboxamide |
| SMILES | C[C@H](CCNC(=O)c1ccc2ccnc(N3CCN(c4ccccc4)CC3)c2c1)N1CCCCCC1 |
| InChI | InChI=1S/C30H39N5O/c1-24(33-17-7-2-3-8-18-33)13-15-32-30(36)26-12-11-25-14-16-31-29(28(25)23-26)35-21-19-34(20-22-35)27-9-5-4-6-10-27/h4-6,9-12,14,16,23-24H,2-3,7-8,13,15,17-22H2,1H3,(H,32,36)/t24-/m1/s1 |
| InChIKey | XMLLJHQEAGMAFH-XMMPIXPASA-N |
| XLogP | 4.95 |
| TPSA | 51.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.68 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |