C28H28N4O2 — CID 53102427
N-[(3-methoxyphenyl)methyl]-1-(4-phenylpiperazin-1-yl)isoquinoline-7-carboxamide (PubChem CID 53102427) has the molecular formula C28H28N4O2 and a molecular weight of 452.56 g/mol. Its IUPAC name is N-[(3-methoxyphenyl)methyl]-1-(4-phenylpiperazin-1-yl)isoquinoline-7-carboxamide.
| Compound Name | N-[(3-methoxyphenyl)methyl]-1-(4-phenylpiperazin-1-yl)isoquinoline-7-carboxamide |
|---|---|
| PubChem CID | 53102427 |
| Molecular Formula | C28H28N4O2 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | N-[(3-methoxyphenyl)methyl]-1-(4-phenylpiperazin-1-yl)isoquinoline-7-carboxamide |
| SMILES | COc1cccc(CNC(=O)c2ccc3ccnc(N4CCN(c5ccccc5)CC4)c3c2)c1 |
| InChI | InChI=1S/C28H28N4O2/c1-34-25-9-5-6-21(18-25)20-30-28(33)23-11-10-22-12-13-29-27(26(22)19-23)32-16-14-31(15-17-32)24-7-3-2-4-8-24/h2-13,18-19H,14-17,20H2,1H3,(H,30,33) |
| InChIKey | DWMMXYXTDGGJFP-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |