C25H28N4O3 — CID 53010018
[1-[4-(4-methoxyphenyl)piperazin-1-yl]isoquinolin-7-yl]-morpholin-4-ylmethanone (PubChem CID 53010018) has the molecular formula C25H28N4O3 and a molecular weight of 432.52 g/mol. Its IUPAC name is [1-[4-(4-methoxyphenyl)piperazin-1-yl]isoquinolin-7-yl]-morpholin-4-ylmethanone.
| Compound Name | [1-[4-(4-methoxyphenyl)piperazin-1-yl]isoquinolin-7-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 53010018 |
| Molecular Formula | C25H28N4O3 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | [1-[4-(4-methoxyphenyl)piperazin-1-yl]isoquinolin-7-yl]-morpholin-4-ylmethanone |
| SMILES | COc1ccc(N2CCN(c3nccc4ccc(C(=O)N5CCOCC5)cc34)CC2)cc1 |
| InChI | InChI=1S/C25H28N4O3/c1-31-22-6-4-21(5-7-22)27-10-12-28(13-11-27)24-23-18-20(3-2-19(23)8-9-26-24)25(30)29-14-16-32-17-15-29/h2-9,18H,10-17H2,1H3 |
| InChIKey | LWQWLKZAXHTPRE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 58.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|