C27H32ClN5O — CID 53102305
[1-[4-(4-chlorophenyl)piperazin-1-yl]isoquinolin-7-yl]-(4-propylpiperazin-1-yl)methanone (PubChem CID 53102305) has the molecular formula C27H32ClN5O and a molecular weight of 478.04 g/mol. Its IUPAC name is [1-[4-(4-chlorophenyl)piperazin-1-yl]isoquinolin-7-yl]-(4-propylpiperazin-1-yl)methanone.
| Compound Name | [1-[4-(4-chlorophenyl)piperazin-1-yl]isoquinolin-7-yl]-(4-propylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 53102305 |
| Molecular Formula | C27H32ClN5O |
| Molecular Weight | 478.04 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | [1-[4-(4-chlorophenyl)piperazin-1-yl]isoquinolin-7-yl]-(4-propylpiperazin-1-yl)methanone |
| SMILES | CCCN1CCN(C(=O)c2ccc3ccnc(N4CCN(c5ccc(Cl)cc5)CC4)c3c2)CC1 |
| InChI | InChI=1S/C27H32ClN5O/c1-2-11-30-12-14-33(15-13-30)27(34)22-4-3-21-9-10-29-26(25(21)20-22)32-18-16-31(17-19-32)24-7-5-23(28)6-8-24/h3-10,20H,2,11-19H2,1H3 |
| InChIKey | LFTASAHMHIOXRQ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 42.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.04 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |