C28H34ClN5O — CID 53102325
1-[4-(4-chlorophenyl)piperazin-1-yl]-N-(3-pyrrolidin-1-ylbutyl)isoquinoline-7-carboxamide (PubChem CID 53102325) has the molecular formula C28H34ClN5O and a molecular weight of 492.07 g/mol. Its IUPAC name is 1-[4-(4-chlorophenyl)piperazin-1-yl]-N-(3-pyrrolidin-1-ylbutyl)isoquinoline-7-carboxamide.
| Compound Name | 1-[4-(4-chlorophenyl)piperazin-1-yl]-N-(3-pyrrolidin-1-ylbutyl)isoquinoline-7-carboxamide |
|---|---|
| PubChem CID | 53102325 |
| Molecular Formula | C28H34ClN5O |
| Molecular Weight | 492.07 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | 1-[4-(4-chlorophenyl)piperazin-1-yl]-N-(3-pyrrolidin-1-ylbutyl)isoquinoline-7-carboxamide |
| SMILES | CC(CCNC(=O)c1ccc2ccnc(N3CCN(c4ccc(Cl)cc4)CC3)c2c1)N1CCCC1 |
| InChI | InChI=1S/C28H34ClN5O/c1-21(32-14-2-3-15-32)10-12-31-28(35)23-5-4-22-11-13-30-27(26(22)20-23)34-18-16-33(17-19-34)25-8-6-24(29)7-9-25/h4-9,11,13,20-21H,2-3,10,12,14-19H2,1H3,(H,31,35) |
| InChIKey | XEPRXGLXZBSZPT-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 51.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.07 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |