C28H27FN4O2 — CID 53102270
N-(3-fluoro-4-methylphenyl)-1-[4-(4-methoxyphenyl)piperazin-1-yl]isoquinoline-7-carboxamide (PubChem CID 53102270) has the molecular formula C28H27FN4O2 and a molecular weight of 470.55 g/mol. Its IUPAC name is N-(3-fluoro-4-methylphenyl)-1-[4-(4-methoxyphenyl)piperazin-1-yl]isoquinoline-7-carboxamide.
| Compound Name | N-(3-fluoro-4-methylphenyl)-1-[4-(4-methoxyphenyl)piperazin-1-yl]isoquinoline-7-carboxamide |
|---|---|
| PubChem CID | 53102270 |
| Molecular Formula | C28H27FN4O2 |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | N-(3-fluoro-4-methylphenyl)-1-[4-(4-methoxyphenyl)piperazin-1-yl]isoquinoline-7-carboxamide |
| SMILES | COc1ccc(N2CCN(c3nccc4ccc(C(=O)Nc5ccc(C)c(F)c5)cc34)CC2)cc1 |
| InChI | InChI=1S/C28H27FN4O2/c1-19-3-6-22(18-26(19)29)31-28(34)21-5-4-20-11-12-30-27(25(20)17-21)33-15-13-32(14-16-33)23-7-9-24(35-2)10-8-23/h3-12,17-18H,13-16H2,1-2H3,(H,31,34) |
| InChIKey | TXCYOGVRTLRQIU-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|