C25H29FN4O2 — CID 53102347
N-(3-ethoxypropyl)-1-[4-(4-fluorophenyl)piperazin-1-yl]isoquinoline-7-carboxamide (PubChem CID 53102347) has the molecular formula C25H29FN4O2 and a molecular weight of 436.53 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-1-[4-(4-fluorophenyl)piperazin-1-yl]isoquinoline-7-carboxamide.
| Compound Name | N-(3-ethoxypropyl)-1-[4-(4-fluorophenyl)piperazin-1-yl]isoquinoline-7-carboxamide |
|---|---|
| PubChem CID | 53102347 |
| Molecular Formula | C25H29FN4O2 |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | N-(3-ethoxypropyl)-1-[4-(4-fluorophenyl)piperazin-1-yl]isoquinoline-7-carboxamide |
| SMILES | CCOCCCNC(=O)c1ccc2ccnc(N3CCN(c4ccc(F)cc4)CC3)c2c1 |
| InChI | InChI=1S/C25H29FN4O2/c1-2-32-17-3-11-28-25(31)20-5-4-19-10-12-27-24(23(19)18-20)30-15-13-29(14-16-30)22-8-6-21(26)7-9-22/h4-10,12,18H,2-3,11,13-17H2,1H3,(H,28,31) |
| InChIKey | GELJWMXJKUBCQK-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|