C29H29FN4O — CID 53102370
N-[(4-ethylphenyl)methyl]-1-[4-(4-fluorophenyl)piperazin-1-yl]isoquinoline-7-carboxamide (PubChem CID 53102370) has the molecular formula C29H29FN4O and a molecular weight of 468.58 g/mol. Its IUPAC name is N-[(4-ethylphenyl)methyl]-1-[4-(4-fluorophenyl)piperazin-1-yl]isoquinoline-7-carboxamide.
| Compound Name | N-[(4-ethylphenyl)methyl]-1-[4-(4-fluorophenyl)piperazin-1-yl]isoquinoline-7-carboxamide |
|---|---|
| PubChem CID | 53102370 |
| Molecular Formula | C29H29FN4O |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | N-[(4-ethylphenyl)methyl]-1-[4-(4-fluorophenyl)piperazin-1-yl]isoquinoline-7-carboxamide |
| SMILES | CCc1ccc(CNC(=O)c2ccc3ccnc(N4CCN(c5ccc(F)cc5)CC4)c3c2)cc1 |
| InChI | InChI=1S/C29H29FN4O/c1-2-21-3-5-22(6-4-21)20-32-29(35)24-8-7-23-13-14-31-28(27(23)19-24)34-17-15-33(16-18-34)26-11-9-25(30)10-12-26/h3-14,19H,2,15-18,20H2,1H3,(H,32,35) |
| InChIKey | JIOLZLRXUCBWPR-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |