C30H32N4O3 — CID 53102444
N-[(4-ethoxy-3-methoxyphenyl)methyl]-1-(4-phenylpiperazin-1-yl)isoquinoline-7-carboxamide (PubChem CID 53102444) has the molecular formula C30H32N4O3 and a molecular weight of 496.61 g/mol. Its IUPAC name is N-[(4-ethoxy-3-methoxyphenyl)methyl]-1-(4-phenylpiperazin-1-yl)isoquinoline-7-carboxamide.
| Compound Name | N-[(4-ethoxy-3-methoxyphenyl)methyl]-1-(4-phenylpiperazin-1-yl)isoquinoline-7-carboxamide |
|---|---|
| PubChem CID | 53102444 |
| Molecular Formula | C30H32N4O3 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | N-[(4-ethoxy-3-methoxyphenyl)methyl]-1-(4-phenylpiperazin-1-yl)isoquinoline-7-carboxamide |
| SMILES | CCOc1ccc(CNC(=O)c2ccc3ccnc(N4CCN(c5ccccc5)CC4)c3c2)cc1OC |
| InChI | InChI=1S/C30H32N4O3/c1-3-37-27-12-9-22(19-28(27)36-2)21-32-30(35)24-11-10-23-13-14-31-29(26(23)20-24)34-17-15-33(16-18-34)25-7-5-4-6-8-25/h4-14,19-20H,3,15-18,21H2,1-2H3,(H,32,35) |
| InChIKey | HLMOZSWVWPYDBJ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |