C29H30N4O4 — CID 53010007
N-(3,4-dimethoxyphenyl)-1-[4-(4-methoxyphenyl)piperazin-1-yl]isoquinoline-7-carboxamide (PubChem CID 53010007) has the molecular formula C29H30N4O4 and a molecular weight of 498.58 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-1-[4-(4-methoxyphenyl)piperazin-1-yl]isoquinoline-7-carboxamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-1-[4-(4-methoxyphenyl)piperazin-1-yl]isoquinoline-7-carboxamide |
|---|---|
| PubChem CID | 53010007 |
| Molecular Formula | C29H30N4O4 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-1-[4-(4-methoxyphenyl)piperazin-1-yl]isoquinoline-7-carboxamide |
| SMILES | COc1ccc(N2CCN(c3nccc4ccc(C(=O)Nc5ccc(OC)c(OC)c5)cc34)CC2)cc1 |
| InChI | InChI=1S/C29H30N4O4/c1-35-24-9-7-23(8-10-24)32-14-16-33(17-15-32)28-25-18-21(5-4-20(25)12-13-30-28)29(34)31-22-6-11-26(36-2)27(19-22)37-3/h4-13,18-19H,14-17H2,1-3H3,(H,31,34) |
| InChIKey | LDRNTJACLULVSP-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 76.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|