C25H29N5O4S — CID 50843614
N-(3,4-dimethoxyphenyl)-2-[4-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanylacetamide (PubChem CID 50843614) has the molecular formula C25H29N5O4S and a molecular weight of 495.61 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-2-[4-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanylacetamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-2-[4-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 50843614 |
| Molecular Formula | C25H29N5O4S |
| Molecular Weight | 495.61 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-2-[4-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanylacetamide |
| SMILES | COc1ccc(N2CCN(c3ccnc(SCC(=O)Nc4ccc(OC)c(OC)c4)n3)CC2)cc1 |
| InChI | InChI=1S/C25H29N5O4S/c1-32-20-7-5-19(6-8-20)29-12-14-30(15-13-29)23-10-11-26-25(28-23)35-17-24(31)27-18-4-9-21(33-2)22(16-18)34-3/h4-11,16H,12-15,17H2,1-3H3,(H,27,31) |
| InChIKey | WXRJFHXNGQZXRZ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.61 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|