C19H23ClN4O2S — CID 53142156
2-[4-(azepan-1-yl)pyrimidin-2-yl]sulfanyl-N-(5-chloro-2-methoxyphenyl)acetamide (PubChem CID 53142156) has the molecular formula C19H23ClN4O2S and a molecular weight of 406.94 g/mol. Its IUPAC name is 2-[4-(azepan-1-yl)pyrimidin-2-yl]sulfanyl-N-(5-chloro-2-methoxyphenyl)acetamide.
| Compound Name | 2-[4-(azepan-1-yl)pyrimidin-2-yl]sulfanyl-N-(5-chloro-2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 53142156 |
| Molecular Formula | C19H23ClN4O2S |
| Molecular Weight | 406.94 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 2-[4-(azepan-1-yl)pyrimidin-2-yl]sulfanyl-N-(5-chloro-2-methoxyphenyl)acetamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)CSc1nccc(N2CCCCCC2)n1 |
| InChI | InChI=1S/C19H23ClN4O2S/c1-26-16-7-6-14(20)12-15(16)22-18(25)13-27-19-21-9-8-17(23-19)24-10-4-2-3-5-11-24/h6-9,12H,2-5,10-11,13H2,1H3,(H,22,25) |
| InChIKey | RJUGAZMHMZWBDW-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.94 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |